JPS63239B2 - - Google Patents
Info
- Publication number
- JPS63239B2 JPS63239B2 JP51076743A JP7674376A JPS63239B2 JP S63239 B2 JPS63239 B2 JP S63239B2 JP 51076743 A JP51076743 A JP 51076743A JP 7674376 A JP7674376 A JP 7674376A JP S63239 B2 JPS63239 B2 JP S63239B2
- Authority
- JP
- Japan
- Prior art keywords
- coating
- pressure
- web
- liquid
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000576 coating method Methods 0.000 claims description 191
- 239000011248 coating agent Substances 0.000 claims description 175
- 239000007788 liquid Substances 0.000 claims description 104
- 238000000034 method Methods 0.000 claims description 39
- 239000003094 microcapsule Substances 0.000 claims description 38
- 239000010410 layer Substances 0.000 claims description 17
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 239000002245 particle Substances 0.000 claims description 6
- 239000002356 single layer Substances 0.000 claims description 3
- 239000000243 solution Substances 0.000 description 42
- 239000003223 protective agent Substances 0.000 description 30
- 239000011230 binding agent Substances 0.000 description 21
- 238000004040 coloring Methods 0.000 description 16
- 239000000203 mixture Substances 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 229920000642 polymer Polymers 0.000 description 14
- -1 xanthene compound Chemical class 0.000 description 14
- 229920000126 latex Polymers 0.000 description 13
- 239000004816 latex Substances 0.000 description 13
- 238000007754 air knife coating Methods 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 239000004927 clay Substances 0.000 description 9
- 238000001035 drying Methods 0.000 description 9
- 230000000694 effects Effects 0.000 description 8
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 7
- 229920003048 styrene butadiene rubber Polymers 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- 229920000084 Gum arabic Polymers 0.000 description 5
- 239000004372 Polyvinyl alcohol Substances 0.000 description 5
- 239000000205 acacia gum Substances 0.000 description 5
- 238000007766 curtain coating Methods 0.000 description 5
- 230000007547 defect Effects 0.000 description 5
- 238000010586 diagram Methods 0.000 description 5
- 229920002451 polyvinyl alcohol Polymers 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- IAUKWGFWINVWKS-UHFFFAOYSA-N 1,2-di(propan-2-yl)naphthalene Chemical compound C1=CC=CC2=C(C(C)C)C(C(C)C)=CC=C21 IAUKWGFWINVWKS-UHFFFAOYSA-N 0.000 description 4
- 244000215068 Acacia senegal Species 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- 235000010489 acacia gum Nutrition 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000008107 starch Substances 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- LIZLYZVAYZQVPG-UHFFFAOYSA-N (3-bromo-2-fluorophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1F LIZLYZVAYZQVPG-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 239000002174 Styrene-butadiene Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 238000005538 encapsulation Methods 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 3
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 3
- 238000007790 scraping Methods 0.000 description 3
- 239000011115 styrene butadiene Substances 0.000 description 3
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 2
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 2
- ATCRIUVQKHMXSH-UHFFFAOYSA-N 2,4-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1Cl ATCRIUVQKHMXSH-UHFFFAOYSA-N 0.000 description 2
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 2
- WHSXTWFYRGOBGO-UHFFFAOYSA-N 3-methylsalicylic acid Chemical compound CC1=CC=CC(C(O)=O)=C1O WHSXTWFYRGOBGO-UHFFFAOYSA-N 0.000 description 2
- HXDOZKJGKXYMEW-UHFFFAOYSA-N 4-ethylphenol Chemical compound CCC1=CC=C(O)C=C1 HXDOZKJGKXYMEW-UHFFFAOYSA-N 0.000 description 2
- YQUQWHNMBPIWGK-UHFFFAOYSA-N 4-isopropylphenol Chemical compound CC(C)C1=CC=C(O)C=C1 YQUQWHNMBPIWGK-UHFFFAOYSA-N 0.000 description 2
- BBEWSMNRCUXQRF-UHFFFAOYSA-N 4-methyl-3-nitrobenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1[N+]([O-])=O BBEWSMNRCUXQRF-UHFFFAOYSA-N 0.000 description 2
- XAICWTLLSRXZPB-UHFFFAOYSA-N 5-tert-butyl-2-hydroxybenzoic acid Chemical compound CC(C)(C)C1=CC=C(O)C(C(O)=O)=C1 XAICWTLLSRXZPB-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- 102000009027 Albumins Human genes 0.000 description 2
- 108010088751 Albumins Proteins 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- ZKURGBYDCVNWKH-UHFFFAOYSA-N [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone Chemical compound C12=CC=C(N(C)C)C=C2SC2=CC(N(C)C)=CC=C2N1C(=O)C1=CC=CC=C1 ZKURGBYDCVNWKH-UHFFFAOYSA-N 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 235000010419 agar Nutrition 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 229940105329 carboxymethylcellulose Drugs 0.000 description 2
- 239000005018 casein Substances 0.000 description 2
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 2
- 235000021240 caseins Nutrition 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000003595 mist Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229920005615 natural polymer Polymers 0.000 description 2
- GJYCVCVHRSWLNY-UHFFFAOYSA-N ortho-butylphenol Natural products CCCCC1=CC=CC=C1O GJYCVCVHRSWLNY-UHFFFAOYSA-N 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 239000005011 phenolic resin Substances 0.000 description 2
- 229920002401 polyacrylamide Polymers 0.000 description 2
- 239000004584 polyacrylic acid Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 235000010413 sodium alginate Nutrition 0.000 description 2
- 239000000661 sodium alginate Substances 0.000 description 2
- 229940005550 sodium alginate Drugs 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 239000003232 water-soluble binding agent Substances 0.000 description 2
- 229920003170 water-soluble synthetic polymer Polymers 0.000 description 2
- RTTZISZSHSCFRH-UHFFFAOYSA-N 1,3-bis(isocyanatomethyl)benzene Chemical compound O=C=NCC1=CC=CC(CN=C=O)=C1 RTTZISZSHSCFRH-UHFFFAOYSA-N 0.000 description 1
- SJJCQDRGABAVBB-UHFFFAOYSA-N 1-hydroxy-2-naphthoic acid Chemical compound C1=CC=CC2=C(O)C(C(=O)O)=CC=C21 SJJCQDRGABAVBB-UHFFFAOYSA-N 0.000 description 1
- QAOJBHRZQQDFHA-UHFFFAOYSA-N 2,3-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1Cl QAOJBHRZQQDFHA-UHFFFAOYSA-N 0.000 description 1
- YKMDNKRCCODWMG-UHFFFAOYSA-N 2,5-dinitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1[N+]([O-])=O YKMDNKRCCODWMG-UHFFFAOYSA-N 0.000 description 1
- DNUYOWCKBJFOGS-UHFFFAOYSA-N 2-[[10-(2,2-dicarboxyethyl)anthracen-9-yl]methyl]propanedioic acid Chemical compound C1=CC=C2C(CC(C(=O)O)C(O)=O)=C(C=CC=C3)C3=C(CC(C(O)=O)C(O)=O)C2=C1 DNUYOWCKBJFOGS-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- DYNFCHNNOHNJFG-UHFFFAOYSA-N 2-formylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C=O DYNFCHNNOHNJFG-UHFFFAOYSA-N 0.000 description 1
- MMBZFKDQNOQTDC-UHFFFAOYSA-N 2-hydroxy-3,5-bis(2-methylbutan-2-yl)benzoic acid Chemical compound CCC(C)(C)C1=CC(C(O)=O)=C(O)C(C(C)(C)CC)=C1 MMBZFKDQNOQTDC-UHFFFAOYSA-N 0.000 description 1
- PWGSBYIHSGBERY-UHFFFAOYSA-N 2-hydroxy-3-methyl-5-(3-methylbutyl)benzoic acid Chemical compound CC(C)CCC1=CC(C)=C(O)C(C(O)=O)=C1 PWGSBYIHSGBERY-UHFFFAOYSA-N 0.000 description 1
- ZJWUEJOPKFYFQD-UHFFFAOYSA-N 2-hydroxy-3-phenylbenzoic acid Chemical compound OC(=O)C1=CC=CC(C=2C=CC=CC=2)=C1O ZJWUEJOPKFYFQD-UHFFFAOYSA-N 0.000 description 1
- ILQOWJVBLNBGAF-UHFFFAOYSA-N 2-hydroxy-5-(3-methylbutyl)benzoic acid Chemical compound CC(C)CCC1=CC=C(O)C(C(O)=O)=C1 ILQOWJVBLNBGAF-UHFFFAOYSA-N 0.000 description 1
- UIYCTSSRJGECEM-UHFFFAOYSA-N 2-hydroxy-5-nonylbenzoic acid Chemical compound CCCCCCCCCC1=CC=C(O)C(C(O)=O)=C1 UIYCTSSRJGECEM-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- UOBYKYZJUGYBDK-UHFFFAOYSA-N 2-naphthoic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CC=C21 UOBYKYZJUGYBDK-UHFFFAOYSA-N 0.000 description 1
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 description 1
- ABJAMKKUHBSXDS-UHFFFAOYSA-N 3,3-bis(6-amino-1,4-dimethylcyclohexa-2,4-dien-1-yl)-2-benzofuran-1-one Chemical compound C1=CC(C)=CC(N)C1(C)C1(C2(C)C(C=C(C)C=C2)N)C2=CC=CC=C2C(=O)O1 ABJAMKKUHBSXDS-UHFFFAOYSA-N 0.000 description 1
- KKBNXPGSTZPGMY-UHFFFAOYSA-N 3,5-di(butan-2-yl)-2-hydroxybenzoic acid Chemical compound CCC(C)C1=CC(C(C)CC)=C(O)C(C(O)=O)=C1 KKBNXPGSTZPGMY-UHFFFAOYSA-N 0.000 description 1
- LWFUFLREGJMOIZ-UHFFFAOYSA-N 3,5-dinitrosalicylic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O LWFUFLREGJMOIZ-UHFFFAOYSA-N 0.000 description 1
- ZWQBZEFLFSFEOS-UHFFFAOYSA-N 3,5-ditert-butyl-2-hydroxybenzoic acid Chemical compound CC(C)(C)C1=CC(C(O)=O)=C(O)C(C(C)(C)C)=C1 ZWQBZEFLFSFEOS-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 1
- MQJTWPAGXWPEKU-UHFFFAOYSA-N 3-[4-(dimethylamino)phenyl]-3-(1,2-dimethylindol-3-yl)-2-benzofuran-1-one Chemical compound C1=CC(N(C)C)=CC=C1C1(C=2C3=CC=CC=C3N(C)C=2C)C2=CC=CC=C2C(=O)O1 MQJTWPAGXWPEKU-UHFFFAOYSA-N 0.000 description 1
- ZKUWHPNJONEJEE-UHFFFAOYSA-N 3-[4-(dimethylamino)phenyl]-3-(2-methyl-1h-indol-3-yl)-2-benzofuran-1-one Chemical compound C1=CC(N(C)C)=CC=C1C1(C=2C3=CC=CC=C3NC=2C)C2=CC=CC=C2C(=O)O1 ZKUWHPNJONEJEE-UHFFFAOYSA-N 0.000 description 1
- WKMGGJIKSXAHAM-UHFFFAOYSA-N 3-[4-(dimethylamino)phenyl]-3-(2-phenyl-1h-indol-3-yl)-2-benzofuran-1-one Chemical compound C1=CC(N(C)C)=CC=C1C1(C=2C3=CC=CC=C3NC=2C=2C=CC=CC=2)C2=CC=CC=C2C(=O)O1 WKMGGJIKSXAHAM-UHFFFAOYSA-N 0.000 description 1
- QRHLHCSHBDVRNB-UHFFFAOYSA-N 3-cyclohexyl-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(C2CCCCC2)=C1O QRHLHCSHBDVRNB-UHFFFAOYSA-N 0.000 description 1
- AWPROQFCCQOROZ-UHFFFAOYSA-N 4-(4-methylpentyl)phenol Chemical compound CC(C)CCCC1=CC=C(O)C=C1 AWPROQFCCQOROZ-UHFFFAOYSA-N 0.000 description 1
- HVXRCAWUNAOCTA-UHFFFAOYSA-N 4-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=C(O)C=C1 HVXRCAWUNAOCTA-UHFFFAOYSA-N 0.000 description 1
- JSFITYFUKSFPBZ-UHFFFAOYSA-N 4-(7-methyloctyl)phenol Chemical compound CC(C)CCCCCCC1=CC=C(O)C=C1 JSFITYFUKSFPBZ-UHFFFAOYSA-N 0.000 description 1
- XZHPXGYRYNDJOD-UHFFFAOYSA-N 4-(8-methylnonyl)phenol Chemical compound CC(C)CCCCCCCC1=CC=C(O)C=C1 XZHPXGYRYNDJOD-UHFFFAOYSA-N 0.000 description 1
- QJGFSVHIXZTITJ-UHFFFAOYSA-N 4-(9-methyldecyl)phenol Chemical compound CC(C)CCCCCCCCC1=CC=C(O)C=C1 QJGFSVHIXZTITJ-UHFFFAOYSA-N 0.000 description 1
- YSNKZJBCZRIRQO-UHFFFAOYSA-N 4-Isopentylphenol Chemical compound CC(C)CCC1=CC=C(O)C=C1 YSNKZJBCZRIRQO-UHFFFAOYSA-N 0.000 description 1
- KLSLBUSXWBJMEC-UHFFFAOYSA-N 4-Propylphenol Chemical compound CCCC1=CC=C(O)C=C1 KLSLBUSXWBJMEC-UHFFFAOYSA-N 0.000 description 1
- PSSUGHHHKLRYEN-UHFFFAOYSA-N 4-bromophenol;formaldehyde Chemical compound O=C.OC1=CC=C(Br)C=C1 PSSUGHHHKLRYEN-UHFFFAOYSA-N 0.000 description 1
- DEXXACGTZUBAMY-UHFFFAOYSA-N 4-chlorophenol;formaldehyde Chemical compound O=C.OC1=CC=C(Cl)C=C1 DEXXACGTZUBAMY-UHFFFAOYSA-N 0.000 description 1
- OAHMVZYHIJQTQC-UHFFFAOYSA-N 4-cyclohexylphenol Chemical compound C1=CC(O)=CC=C1C1CCCCC1 OAHMVZYHIJQTQC-UHFFFAOYSA-N 0.000 description 1
- CGTLMVREWQIWEC-UHFFFAOYSA-N 4-decylphenol Chemical compound CCCCCCCCCCC1=CC=C(O)C=C1 CGTLMVREWQIWEC-UHFFFAOYSA-N 0.000 description 1
- DAAUPLAGEPKEBZ-UHFFFAOYSA-N 4-fluorophenol;formaldehyde Chemical compound O=C.OC1=CC=C(F)C=C1 DAAUPLAGEPKEBZ-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- NJESAXZANHETJV-UHFFFAOYSA-N 4-methylsalicylic acid Chemical compound CC1=CC=C(C(O)=O)C(O)=C1 NJESAXZANHETJV-UHFFFAOYSA-N 0.000 description 1
- SZWBRVPZWJYIHI-UHFFFAOYSA-N 4-n-Hexylphenol Chemical compound CCCCCCC1=CC=C(O)C=C1 SZWBRVPZWJYIHI-UHFFFAOYSA-N 0.000 description 1
- ZNPSUQQXTRRSBM-UHFFFAOYSA-N 4-n-Pentylphenol Chemical compound CCCCCC1=CC=C(O)C=C1 ZNPSUQQXTRRSBM-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N 4-nonylphenol Chemical compound CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- NTDQQZYCCIDJRK-UHFFFAOYSA-N 4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C=C1 NTDQQZYCCIDJRK-UHFFFAOYSA-N 0.000 description 1
- KDVYCTOWXSLNNI-UHFFFAOYSA-N 4-t-Butylbenzoic acid Chemical compound CC(C)(C)C1=CC=C(C(O)=O)C=C1 KDVYCTOWXSLNNI-UHFFFAOYSA-N 0.000 description 1
- XJEHLEHQNAUGKA-UHFFFAOYSA-N 4-undecylphenol Chemical compound CCCCCCCCCCCC1=CC=C(O)C=C1 XJEHLEHQNAUGKA-UHFFFAOYSA-N 0.000 description 1
- RNRINRUTVAFUCG-UHFFFAOYSA-N 5-(dimethylamino)-3,3-bis(1,2-dimethylindol-3-yl)-2-benzofuran-1-one Chemical compound C1=CC=C2C(C3(C=4C5=CC=CC=C5N(C)C=4C)OC(=O)C4=CC=C(C=C43)N(C)C)=C(C)N(C)C2=C1 RNRINRUTVAFUCG-UHFFFAOYSA-N 0.000 description 1
- ZKIANJBTYMAVTC-UHFFFAOYSA-N 5-(dimethylamino)-3,3-bis(2-phenyl-1h-indol-3-yl)-2-benzofuran-1-one Chemical compound C12=CC(N(C)C)=CC=C2C(=O)OC1(C=1C2=CC=CC=C2NC=1C=1C=CC=CC=1)C(C1=CC=CC=C1N1)=C1C1=CC=CC=C1 ZKIANJBTYMAVTC-UHFFFAOYSA-N 0.000 description 1
- KJFCMURGEOJJFA-UHFFFAOYSA-N 5-(dimethylamino)-3,3-bis(9-ethylcarbazol-3-yl)-2-benzofuran-1-one Chemical compound C1=CC=C2C3=CC(C4(C5=CC(=CC=C5C(=O)O4)N(C)C)C=4C=C5C6=CC=CC=C6N(C5=CC=4)CC)=CC=C3N(CC)C2=C1 KJFCMURGEOJJFA-UHFFFAOYSA-N 0.000 description 1
- GZEPXNUXMPYSOQ-UHFFFAOYSA-N 5-cyclohexyl-2-hydroxybenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(C2CCCCC2)=C1 GZEPXNUXMPYSOQ-UHFFFAOYSA-N 0.000 description 1
- SCOPDLDXQYWODG-UHFFFAOYSA-N 5-tert-butyl-2-hydroxy-3-methylbenzoic acid Chemical compound CC1=CC(C(C)(C)C)=CC(C(O)=O)=C1O SCOPDLDXQYWODG-UHFFFAOYSA-N 0.000 description 1
- QAYNSPOKTRVZRC-UHFFFAOYSA-N 99-60-5 Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1Cl QAYNSPOKTRVZRC-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 108010076119 Caseins Proteins 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- IPAJDLMMTVZVPP-UHFFFAOYSA-N Crystal violet lactone Chemical compound C1=CC(N(C)C)=CC=C1C1(C=2C=CC(=CC=2)N(C)C)C2=CC=C(N(C)C)C=C2C(=O)O1 IPAJDLMMTVZVPP-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- 238000012695 Interfacial polymerization Methods 0.000 description 1
- 244000151018 Maranta arundinacea Species 0.000 description 1
- 235000010804 Maranta arundinacea Nutrition 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- QSACCXVHEVWNMX-UHFFFAOYSA-N N-acetylanthranilic acid Chemical compound CC(=O)NC1=CC=CC=C1C(O)=O QSACCXVHEVWNMX-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical group [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 235000012419 Thalia geniculata Nutrition 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 159000000006 cesium salts Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000011981 development test Methods 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical class C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- ZWJINEZUASEZBH-UHFFFAOYSA-N fenamic acid Chemical compound OC(=O)C1=CC=CC=C1NC1=CC=CC=C1 ZWJINEZUASEZBH-UHFFFAOYSA-N 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- XPKFJIVNCKUXOI-UHFFFAOYSA-N formaldehyde;2-hydroxybenzoic acid Chemical compound O=C.OC(=O)C1=CC=CC=C1O XPKFJIVNCKUXOI-UHFFFAOYSA-N 0.000 description 1
- LKRSCNTVLMFZFK-UHFFFAOYSA-N formaldehyde;4-hydroxybenzoic acid Chemical compound O=C.OC(=O)C1=CC=C(O)C=C1 LKRSCNTVLMFZFK-UHFFFAOYSA-N 0.000 description 1
- DPNQOXAHBVTRJU-UHFFFAOYSA-N formaldehyde;4-iodophenol Chemical compound O=C.OC1=CC=C(I)C=C1 DPNQOXAHBVTRJU-UHFFFAOYSA-N 0.000 description 1
- GXRKWLKYJMKXCV-UHFFFAOYSA-N formaldehyde;4-nitrophenol Chemical compound O=C.OC1=CC=C([N+]([O-])=O)C=C1 GXRKWLKYJMKXCV-UHFFFAOYSA-N 0.000 description 1
- UMGLBLXWFVODRF-UHFFFAOYSA-N formaldehyde;4-phenylphenol Chemical compound O=C.C1=CC(O)=CC=C1C1=CC=CC=C1 UMGLBLXWFVODRF-UHFFFAOYSA-N 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000009499 grossing Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- QTWZICCBKBYHDM-UHFFFAOYSA-N leucomethylene blue Chemical compound C1=C(N(C)C)C=C2SC3=CC(N(C)C)=CC=C3NC2=C1 QTWZICCBKBYHDM-UHFFFAOYSA-N 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000000691 measurement method Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- IJFXRHURBJZNAO-UHFFFAOYSA-N meta--hydroxybenzoic acid Natural products OC(=O)C1=CC=CC(O)=C1 IJFXRHURBJZNAO-UHFFFAOYSA-N 0.000 description 1
- HPDABTZAYLFFDV-UHFFFAOYSA-N methyl 1-(6-chloropyridazin-3-yl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)CCN1C1=CC=C(Cl)N=N1 HPDABTZAYLFFDV-UHFFFAOYSA-N 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- KIHUPOKUSVEICJ-UHFFFAOYSA-N nonyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 KIHUPOKUSVEICJ-UHFFFAOYSA-N 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 1
- CKMXAIVXVKGGFM-UHFFFAOYSA-N p-cumic acid Chemical compound CC(C)C1=CC=C(C(O)=O)C=C1 CKMXAIVXVKGGFM-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000447 polyanionic polymer Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 235000015277 pork Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 150000003413 spiro compounds Chemical class 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 150000004897 thiazines Chemical class 0.000 description 1
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 1
- 229940103494 thiosalicylic acid Drugs 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/1246—Application of the layer, e.g. by printing
Landscapes
- Color Printing (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Application Of Or Painting With Fluid Materials (AREA)
- Coating Apparatus (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7674376A JPS532108A (en) | 1976-06-28 | 1976-06-28 | Method of producing pressure sensitixed copy sheets |
| ES460112A ES460112A1 (es) | 1976-06-28 | 1977-06-27 | Procedimiento para producir papel copiador sensible a la presion. |
| BR7704192A BR7704192A (pt) | 1976-06-28 | 1977-06-27 | Processo para produzir um papel de copia sensivel a pressao |
| GB27076/77A GB1550023A (en) | 1976-06-28 | 1977-06-28 | Process for producing pressure-sensitive recording sheet |
| DE2729143A DE2729143C3 (de) | 1976-06-28 | 1977-06-28 | Anwendung des Vorhangbeschichtungsverfahrens zur Herstellung druckempfindlicher Kopierpapiere vom Mikrokapseltyp |
| US05/878,353 US4230743A (en) | 1976-06-28 | 1978-02-16 | Process for producing pressure-sensitive copying paper |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7674376A JPS532108A (en) | 1976-06-28 | 1976-06-28 | Method of producing pressure sensitixed copy sheets |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS532108A JPS532108A (en) | 1978-01-10 |
| JPS63239B2 true JPS63239B2 (en]) | 1988-01-06 |
Family
ID=13614076
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP7674376A Granted JPS532108A (en) | 1976-06-28 | 1976-06-28 | Method of producing pressure sensitixed copy sheets |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4230743A (en]) |
| JP (1) | JPS532108A (en]) |
| BR (1) | BR7704192A (en]) |
| DE (1) | DE2729143C3 (en]) |
| ES (1) | ES460112A1 (en]) |
| GB (1) | GB1550023A (en]) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5739985A (en) * | 1980-08-22 | 1982-03-05 | Fuji Photo Film Co Ltd | Manufacture for pressure-sensitive recording sheet |
| DE3117242A1 (de) * | 1981-04-30 | 1982-11-18 | Bayer Ag, 5090 Leverkusen | Flexodruckfarben fuer die herstellung von reaktionsdurchschreibepapieren |
| US4822769A (en) * | 1985-06-12 | 1989-04-18 | Nashua Corporation | High solids content coated back paper |
| JPS6380877A (ja) * | 1986-09-25 | 1988-04-11 | Nippon Steel Corp | ローラーカーテンコーターによる塗装方法 |
| JPS6391171A (ja) * | 1986-10-06 | 1988-04-21 | Fuji Photo Film Co Ltd | 塗布方法 |
| CA1339023C (en) * | 1987-12-01 | 1997-03-25 | Toranosuke Saito | Developer for pressure-sensitive recording sheets, aqueous dispersion of the developer and method for preparing the developer |
| JPH01199668A (ja) * | 1988-02-01 | 1989-08-11 | Fuji Photo Film Co Ltd | 塗布装置 |
| JPH074568B2 (ja) * | 1988-06-07 | 1995-01-25 | 富士写真フイルム株式会社 | 塗布方法 |
| JP2632004B2 (ja) * | 1988-06-15 | 1997-07-16 | 富士写真フイルム株式会社 | 感圧記録シート用マイクロカプセルの製造法 |
| DE69010191T2 (de) * | 1990-05-04 | 1995-01-05 | Stora Byggprodukter Ab | Vorrichtung und Verfahren zum Auftragen von Farbe oder Lack mittels eines Giessvorhangs. |
| US5206057A (en) * | 1992-01-10 | 1993-04-27 | Eastman Kodak Company | Method and apparatus for adjusting the curtain impingement line in a curtain coating apparatus |
| AU668381B2 (en) * | 1992-03-06 | 1996-05-02 | Nashua Corporation | Xerographable carbonless forms |
| US5792317A (en) * | 1996-02-07 | 1998-08-11 | Gl&V-Paper Machine Group, Inc. | Wet end starch application |
| US5997692A (en) * | 1996-02-07 | 1999-12-07 | Gl&V-Paper Machine Group, Inc. | Profiling wet end starch applicator |
| DE19716647A1 (de) * | 1997-04-21 | 1998-10-22 | Jagenberg Papiertech Gmbh | Verfahren und Vorrichtung zum Auftragen einer Pigmentstreichfarbe auf eine Papier- oder Kartonbahn |
| US5885660A (en) * | 1998-01-22 | 1999-03-23 | Eastman Kodak Company | Coating surfaces with a free falling coating composition, using a basin with a wall dividing the basin into two channels |
| DE10057729A1 (de) * | 2000-11-22 | 2002-05-23 | Voith Paper Patent Gmbh | Vorhang-Auftragsvorrichtung |
| EP1249533A1 (en) * | 2001-04-14 | 2002-10-16 | The Dow Chemical Company | Process for making multilayer coated paper or paperboard |
| US7473333B2 (en) * | 2002-04-12 | 2009-01-06 | Dow Global Technologies Inc. | Process for making coated paper or paperboard |
| US7364774B2 (en) * | 2002-04-12 | 2008-04-29 | Dow Global Technologies Inc. | Method of producing a multilayer coated substrate having improved barrier properties |
| US20030194501A1 (en) * | 2002-04-12 | 2003-10-16 | Robert Urscheler | Method of producing a coated substrate |
| WO2004035929A1 (en) | 2002-10-15 | 2004-04-29 | Dow Global Technologies Inc. | Method of producing a multilayer coated substrate having improved barrier properties |
| WO2004035931A1 (en) | 2002-10-15 | 2004-04-29 | Dow Global Technologies Inc. | Process for making coated paper or paperboard |
| AU2002337877A1 (en) * | 2002-10-15 | 2004-05-04 | Dow Global Technologies Inc. | A method of producing a coated substrate |
| US20040121080A1 (en) * | 2002-10-17 | 2004-06-24 | Robert Urscheler | Method of producing a coated substrate |
| DE20321815U1 (de) * | 2003-05-06 | 2010-07-22 | Voith Patent Gmbh | Mehrschicht-Auftragsvorrichtung zum Auftragen von Auftragsmedium im Wege wenigstens eines mehrschichtigen Vorhangs oder Schleiers |
| DE10343120A1 (de) * | 2003-09-17 | 2005-04-21 | Voith Paper Patent Gmbh | Verfahren zum Streichen einer Materialbahn |
| DE10359122A1 (de) * | 2003-12-17 | 2005-07-14 | Voith Paper Patent Gmbh | Auftragsvorrichtung |
| DE102004011230B4 (de) * | 2004-03-04 | 2005-12-29 | Papierfabrik August Koehler Ag | Verfahren zur Herstellung eines Thermopapiers |
| JP4542816B2 (ja) * | 2004-05-18 | 2010-09-15 | ボイス ペ−パ− パテント ゲ−エムベ−ハ− | カーテン式コータ |
| JP2006015340A (ja) * | 2004-07-02 | 2006-01-19 | Metso Paper Inc | カーテンコーター |
| AU2005285221B2 (en) * | 2004-09-09 | 2010-11-11 | Avery Dennison Corporation | Curtain coating method |
| WO2006038381A1 (ja) * | 2004-09-30 | 2006-04-13 | Nippon Paper Industries Co., Ltd. | 感熱記録体の製造方法 |
| DE102007009702A1 (de) * | 2007-02-28 | 2008-09-04 | Voith Patent Gmbh | Verfahren zur Herstellung einer beschichteten Faserstoffbahn, insbesondere aus Papier oder Karton |
| JP2009226241A (ja) * | 2008-03-19 | 2009-10-08 | Konica Minolta Holdings Inc | 多層同時塗布方法 |
| DE102009054737A1 (de) * | 2009-12-16 | 2011-06-22 | Voith Patent GmbH, 89522 | Vorhang-Auftragswerk |
| DE102010001164A1 (de) * | 2010-01-25 | 2011-07-28 | Voith Patent GmbH, 89522 | Thermopapier- oder Selbstdurchschreibepapiermaschine und Verfahren zur Herstellung von Thermo- oder Selbstdurchschreibepapier |
| EP3496868A4 (en) * | 2016-08-09 | 2020-04-29 | IKEA Supply AG | Device and method for applying paint on objects |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE553416A (en]) * | 1955-12-17 | |||
| US3205089A (en) * | 1959-12-04 | 1965-09-07 | Gasway Corp | Method and apparatus for flow coating objects |
| US3461840A (en) * | 1966-04-04 | 1969-08-19 | Turner Mfg Co | Curtain coating apparatus for applying coating materials |
| US3508947A (en) * | 1968-06-03 | 1970-04-28 | Eastman Kodak Co | Method for simultaneously applying a plurality of coated layers by forming a stable multilayer free-falling vertical curtain |
| US3632374A (en) * | 1968-06-03 | 1972-01-04 | Eastman Kodak Co | Method of making photographic elements |
| JPS527373B2 (en]) * | 1972-08-15 | 1977-03-02 | ||
| US3963852A (en) * | 1973-08-04 | 1976-06-15 | Moore Business Forms, Inc. | Clay-coated record material of improved image durability |
| JPS579956B2 (en]) * | 1973-10-02 | 1982-02-24 | ||
| JPS5748397B2 (en]) * | 1973-10-12 | 1982-10-15 | ||
| GB1476787A (en) * | 1974-07-04 | 1977-06-16 | Wiggins Teape Ltd | Coated sheet material |
| CH591902A5 (en]) * | 1975-05-14 | 1977-10-14 | Ciba Geigy Ag |
-
1976
- 1976-06-28 JP JP7674376A patent/JPS532108A/ja active Granted
-
1977
- 1977-06-27 ES ES460112A patent/ES460112A1/es not_active Expired
- 1977-06-27 BR BR7704192A patent/BR7704192A/pt unknown
- 1977-06-28 DE DE2729143A patent/DE2729143C3/de not_active Expired
- 1977-06-28 GB GB27076/77A patent/GB1550023A/en not_active Expired
-
1978
- 1978-02-16 US US05/878,353 patent/US4230743A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2729143A1 (de) | 1978-01-05 |
| BR7704192A (pt) | 1978-03-28 |
| JPS532108A (en) | 1978-01-10 |
| ES460112A1 (es) | 1978-05-01 |
| DE2729143B2 (de) | 1979-11-29 |
| GB1550023A (en) | 1979-08-08 |
| US4230743A (en) | 1980-10-28 |
| DE2729143C3 (de) | 1980-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS63239B2 (en]) | ||
| EP0011367A1 (en) | Pressure-sensitive recording material and process for its production, coating composition, capsules and microcapsules therefor | |
| US4234212A (en) | Recording sheet | |
| US4400437A (en) | Thermal recording paper | |
| DE2447103A1 (de) | Druckempfindliche aufzeichnungsbahn | |
| US3955025A (en) | Pressure-sensitive copying sheet | |
| DE2919521C2 (de) | Aufzeichnungsmaterial zur Anwendung in einem druckempfindlichen Kopiersystem | |
| US4289332A (en) | Recording sheet | |
| DE2703574A1 (de) | Aufzeichnungsmaterial | |
| DE2457897A1 (de) | Aufzeichnungsblatt | |
| JPH0232153B2 (en]) | ||
| US4418942A (en) | Microcapsule sheet for pressure-sensitive recording paper | |
| US4408781A (en) | Recording materials | |
| DE2553083A1 (de) | Verfahren zur herstellung eines oertlich desensibilisierten farbenentwicklerbogens | |
| GB2085757A (en) | Method of producing pressure sensitive recording sheet | |
| DE2513468C2 (de) | Verfahren zur Herstellung eines Farbentwicklers | |
| JPS5819474B2 (ja) | キロクシ−ト | |
| DE69101746T2 (de) | Wärmeempfindliches Aufzeichnungsmaterial. | |
| DE3911199C2 (en]) | ||
| JPS6021875B2 (ja) | 記録材料 | |
| JPS647597B2 (en]) | ||
| US4559242A (en) | Method of preparing color developer sheets | |
| JPS6146187B2 (en]) | ||
| JPS646038B2 (en]) | ||
| DE2407622A1 (de) | Aufzeichnungsbogen |